C15H22ClFN2O — CID 119397919
(2-fluoro-4-methylphenyl)-[3-(methylaminomethyl)piperidin-1-yl]methanone;hydrochloride (PubChem CID 119397919) has the molecular formula C15H22ClFN2O and a molecular weight of 300.81 g/mol. Its IUPAC name is (2-fluoro-4-methylphenyl)-[3-(methylaminomethyl)piperidin-1-yl]methanone;hydrochloride.
| Compound Name | (2-fluoro-4-methylphenyl)-[3-(methylaminomethyl)piperidin-1-yl]methanone;hydrochloride |
|---|---|
| PubChem CID | 119397919 |
| Molecular Formula | C15H22ClFN2O |
| Molecular Weight | 300.81 g/mol |
| Exact Mass | 300.14 |
| IUPAC Name | (2-fluoro-4-methylphenyl)-[3-(methylaminomethyl)piperidin-1-yl]methanone;hydrochloride |
| SMILES | CNCC1CCCN(C(=O)c2ccc(C)cc2F)C1.Cl |
| InChI | InChI=1S/C15H21FN2O.ClH/c1-11-5-6-13(14(16)8-11)15(19)18-7-3-4-12(10-18)9-17-2;/h5-6,8,12,17H,3-4,7,9-10H2,1-2H3;1H |
| InChIKey | DWEILLWJDRNQIY-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.81 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |