C16H31ClN2O — CID 119398426
cyclooctyl-[3-(methylaminomethyl)piperidin-1-yl]methanone;hydrochloride (PubChem CID 119398426) has the molecular formula C16H31ClN2O and a molecular weight of 302.89 g/mol. Its IUPAC name is cyclooctyl-[3-(methylaminomethyl)piperidin-1-yl]methanone;hydrochloride.
| Compound Name | cyclooctyl-[3-(methylaminomethyl)piperidin-1-yl]methanone;hydrochloride |
|---|---|
| PubChem CID | 119398426 |
| Molecular Formula | C16H31ClN2O |
| Molecular Weight | 302.89 g/mol |
| Exact Mass | 302.21 |
| IUPAC Name | cyclooctyl-[3-(methylaminomethyl)piperidin-1-yl]methanone;hydrochloride |
| SMILES | CNCC1CCCN(C(=O)C2CCCCCCC2)C1.Cl |
| InChI | InChI=1S/C16H30N2O.ClH/c1-17-12-14-8-7-11-18(13-14)16(19)15-9-5-3-2-4-6-10-15;/h14-15,17H,2-13H2,1H3;1H |
| InChIKey | HSZXPWASDDEQMR-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.89 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |