C16H25ClN2O — CID 119399894
(2R)-N-(2-tert-butylphenyl)piperidine-2-carboxamide;hydrochloride (PubChem CID 119399894) has the molecular formula C16H25ClN2O and a molecular weight of 296.84 g/mol. Its IUPAC name is (2R)-N-(2-tert-butylphenyl)piperidine-2-carboxamide;hydrochloride.
| Compound Name | (2R)-N-(2-tert-butylphenyl)piperidine-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119399894 |
| Molecular Formula | C16H25ClN2O |
| Molecular Weight | 296.84 g/mol |
| Exact Mass | 296.17 |
| IUPAC Name | (2R)-N-(2-tert-butylphenyl)piperidine-2-carboxamide;hydrochloride |
| SMILES | CC(C)(C)c1ccccc1NC(=O)[C@H]1CCCCN1.Cl |
| InChI | InChI=1S/C16H24N2O.ClH/c1-16(2,3)12-8-4-5-9-13(12)18-15(19)14-10-6-7-11-17-14;/h4-5,8-9,14,17H,6-7,10-11H2,1-3H3,(H,18,19);1H/t14-;/m1./s1 |
| InChIKey | LUVZYYKMBGCFFP-PFEQFJNWSA-N |
| XLogP | 3.49 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.84 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |