C14H16ClFN4O — CID 119400312
[1-(4-fluorophenyl)pyrazol-3-yl]-piperazin-1-ylmethanone;hydrochloride (PubChem CID 119400312) has the molecular formula C14H16ClFN4O and a molecular weight of 310.76 g/mol. Its IUPAC name is [1-(4-fluorophenyl)pyrazol-3-yl]-piperazin-1-ylmethanone;hydrochloride.
| Compound Name | [1-(4-fluorophenyl)pyrazol-3-yl]-piperazin-1-ylmethanone;hydrochloride |
|---|---|
| PubChem CID | 119400312 |
| Molecular Formula | C14H16ClFN4O |
| Molecular Weight | 310.76 g/mol |
| Exact Mass | 310.10 |
| IUPAC Name | [1-(4-fluorophenyl)pyrazol-3-yl]-piperazin-1-ylmethanone;hydrochloride |
| SMILES | Cl.O=C(c1ccn(-c2ccc(F)cc2)n1)N1CCNCC1 |
| InChI | InChI=1S/C14H15FN4O.ClH/c15-11-1-3-12(4-2-11)19-8-5-13(17-19)14(20)18-9-6-16-7-10-18;/h1-5,8,16H,6-7,9-10H2;1H |
| InChIKey | FSCPOKGFVXBBTE-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.76 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |