C24H31N4O4S+ — CID 11940046
(3aR,4R,6R,7R,7aR)-6,7-dihydroxy-N-(2-morpholin-4-ium-4-ylethyl)-3-naphthalen-1-yl-2-sulfanylidene-3a,4,5,6,7,7a-hexahydro-1H-benzimidazole-4-carboxamide (PubChem CID 11940046) has the molecular formula C24H31N4O4S+ and a molecular weight of 471.60 g/mol. Its IUPAC name is (3aR,4R,6R,7R,7aR)-6,7-dihydroxy-N-(2-morpholin-4-ium-4-ylethyl)-3-naphthalen-1-yl-2-sulfanylidene-3a,4,5,6,7,7a-hexahydro-1H-benzimidazole-4-carboxamide.
| Compound Name | (3aR,4R,6R,7R,7aR)-6,7-dihydroxy-N-(2-morpholin-4-ium-4-ylethyl)-3-naphthalen-1-yl-2-sulfanylidene-3a,4,5,6,7,7a-hexahydro-1H-benzimidazole-4-carboxamide |
|---|---|
| PubChem CID | 11940046 |
| Molecular Formula | C24H31N4O4S+ |
| Molecular Weight | 471.60 g/mol |
| Exact Mass | 471.21 |
| IUPAC Name | (3aR,4R,6R,7R,7aR)-6,7-dihydroxy-N-(2-morpholin-4-ium-4-ylethyl)-3-naphthalen-1-yl-2-sulfanylidene-3a,4,5,6,7,7a-hexahydro-1H-benzimidazole-4-carboxamide |
| SMILES | O=C(NCC[NH+]1CCOCC1)[C@@H]1C[C@@H](O)[C@H](O)[C@@H]2NC(=S)N(c3cccc4ccccc34)[C@@H]21 |
| InChI | InChI=1S/C24H30N4O4S/c29-19-14-17(23(31)25-8-9-27-10-12-32-13-11-27)21-20(22(19)30)26-24(33)28(21)18-7-3-5-15-4-1-2-6-16(15)18/h1-7,17,19-22,29-30H,8-14H2,(H,25,31)(H,26,33)/p+1/t17-,19-,20-,21-,22+/m1/s1 |
| InChIKey | ONLBLVTYIRZBNM-FYKMYLNBSA-O |
| XLogP | -0.96 |
| TPSA | 98.50 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.60 |
| LogP ≤ 5 | -0.96 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|