C24H30N4O4S — CID 11940049
(3aS,4R,5R,7R,7aR)-4,5-dihydroxy-N-(2-morpholin-4-ylethyl)-2-(naphthalen-1-ylamino)-3a,4,5,6,7,7a-hexahydro-1,3-benzothiazole-7-carboxamide (PubChem CID 11940049) has the molecular formula C24H30N4O4S and a molecular weight of 470.60 g/mol. Its IUPAC name is (3aS,4R,5R,7R,7aR)-4,5-dihydroxy-N-(2-morpholin-4-ylethyl)-2-(naphthalen-1-ylamino)-3a,4,5,6,7,7a-hexahydro-1,3-benzothiazole-7-carboxamide.
| Compound Name | (3aS,4R,5R,7R,7aR)-4,5-dihydroxy-N-(2-morpholin-4-ylethyl)-2-(naphthalen-1-ylamino)-3a,4,5,6,7,7a-hexahydro-1,3-benzothiazole-7-carboxamide |
|---|---|
| PubChem CID | 11940049 |
| Molecular Formula | C24H30N4O4S |
| Molecular Weight | 470.60 g/mol |
| Exact Mass | 470.20 |
| IUPAC Name | (3aS,4R,5R,7R,7aR)-4,5-dihydroxy-N-(2-morpholin-4-ylethyl)-2-(naphthalen-1-ylamino)-3a,4,5,6,7,7a-hexahydro-1,3-benzothiazole-7-carboxamide |
| SMILES | O=C(NCCN1CCOCC1)[C@H]1C[C@@H](O)[C@H](O)[C@@H]2N=C(Nc3cccc4ccccc34)S[C@@H]21 |
| InChI | InChI=1S/C24H30N4O4S/c29-19-14-17(23(31)25-8-9-28-10-12-32-13-11-28)22-20(21(19)30)27-24(33-22)26-18-7-3-5-15-4-1-2-6-16(15)18/h1-7,17,19-22,29-30H,8-14H2,(H,25,31)(H,26,27)/t17-,19+,20-,21-,22+/m0/s1 |
| InChIKey | FZNDUAQRMCRXEC-WFMNFSIZSA-N |
| XLogP | 1.28 |
| TPSA | 106.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.60 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |