C23H24F3N3O3S — CID 11940069
(3aS,4R,5R,7R,7aR)-N-benzyl-4,5-dihydroxy-N-methyl-2-[3-(trifluoromethyl)anilino]-3a,4,5,6,7,7a-hexahydro-1,3-benzothiazole-7-carboxamide (PubChem CID 11940069) has the molecular formula C23H24F3N3O3S and a molecular weight of 479.52 g/mol. Its IUPAC name is (3aS,4R,5R,7R,7aR)-N-benzyl-4,5-dihydroxy-N-methyl-2-[3-(trifluoromethyl)anilino]-3a,4,5,6,7,7a-hexahydro-1,3-benzothiazole-7-carboxamide.
| Compound Name | (3aS,4R,5R,7R,7aR)-N-benzyl-4,5-dihydroxy-N-methyl-2-[3-(trifluoromethyl)anilino]-3a,4,5,6,7,7a-hexahydro-1,3-benzothiazole-7-carboxamide |
|---|---|
| PubChem CID | 11940069 |
| Molecular Formula | C23H24F3N3O3S |
| Molecular Weight | 479.52 g/mol |
| Exact Mass | 479.15 |
| IUPAC Name | (3aS,4R,5R,7R,7aR)-N-benzyl-4,5-dihydroxy-N-methyl-2-[3-(trifluoromethyl)anilino]-3a,4,5,6,7,7a-hexahydro-1,3-benzothiazole-7-carboxamide |
| SMILES | CN(Cc1ccccc1)C(=O)[C@H]1C[C@@H](O)[C@H](O)[C@@H]2N=C(Nc3cccc(C(F)(F)F)c3)S[C@@H]21 |
| InChI | InChI=1S/C23H24F3N3O3S/c1-29(12-13-6-3-2-4-7-13)21(32)16-11-17(30)19(31)18-20(16)33-22(28-18)27-15-9-5-8-14(10-15)23(24,25)26/h2-10,16-20,30-31H,11-12H2,1H3,(H,27,28)/t16-,17+,18-,19-,20+/m0/s1 |
| InChIKey | VAZPPTBPNHUOBC-LJDSDSDDSA-N |
| XLogP | 3.36 |
| TPSA | 85.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.52 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |