C21H32N3O4S+ — CID 11940294
ethyl 2-[[2-[(4aR,8aS)-1,2,3,4,4a,5,6,7,8,8a-decahydroisoquinolin-2-ium-2-yl]acetyl]amino]-4-methyl-5-(methylcarbamoyl)thiophene-3-carboxylate (PubChem CID 11940294) has the molecular formula C21H32N3O4S+ and a molecular weight of 422.57 g/mol. Its IUPAC name is ethyl 2-[[2-[(4aR,8aS)-1,2,3,4,4a,5,6,7,8,8a-decahydroisoquinolin-2-ium-2-yl]acetyl]amino]-4-methyl-5-(methylcarbamoyl)thiophene-3-carboxylate.
| Compound Name | ethyl 2-[[2-[(4aR,8aS)-1,2,3,4,4a,5,6,7,8,8a-decahydroisoquinolin-2-ium-2-yl]acetyl]amino]-4-methyl-5-(methylcarbamoyl)thiophene-3-carboxylate |
|---|---|
| PubChem CID | 11940294 |
| Molecular Formula | C21H32N3O4S+ |
| Molecular Weight | 422.57 g/mol |
| Exact Mass | 422.21 |
| IUPAC Name | ethyl 2-[[2-[(4aR,8aS)-1,2,3,4,4a,5,6,7,8,8a-decahydroisoquinolin-2-ium-2-yl]acetyl]amino]-4-methyl-5-(methylcarbamoyl)thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)C[NH+]2CC[C@H]3CCCC[C@@H]3C2)sc(C(=O)NC)c1C |
| InChI | InChI=1S/C21H31N3O4S/c1-4-28-21(27)17-13(2)18(19(26)22-3)29-20(17)23-16(25)12-24-10-9-14-7-5-6-8-15(14)11-24/h14-15H,4-12H2,1-3H3,(H,22,26)(H,23,25)/p+1/t14-,15-/m1/s1 |
| InChIKey | GAOCLMWYVUXYJG-HUUCEWRRSA-O |
| XLogP | 1.63 |
| TPSA | 88.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.57 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |