About [2-[(6-methylimidazo[1,2-a]pyridin-2-yl)methoxy]phenyl]-piperazin-1-ylmethanone
[2-[(6-methylimidazo[1,2-a]pyridin-2-yl)methoxy]phenyl]-piperazin-1-ylmethanone (PubChem CID 119402980) has the molecular formula C20H22N4O2
and a molecular weight of 350.42 g/mol. Its IUPAC name is [2-[(6-methylimidazo[1,2-a]pyridin-2-yl)methoxy]phenyl]-piperazin-1-ylmethanone.
Molecular Properties
| Compound Name | [2-[(6-methylimidazo[1,2-a]pyridin-2-yl)methoxy]phenyl]-piperazin-1-ylmethanone |
| PubChem CID | 119402980 |
| Molecular Formula | C20H22N4O2 |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.17 |
| IUPAC Name | [2-[(6-methylimidazo[1,2-a]pyridin-2-yl)methoxy]phenyl]-piperazin-1-ylmethanone |
| SMILES | Cc1ccc2nc(COc3ccccc3C(=O)N3CCNCC3)cn2c1 |
| InChI | InChI=1S/C20H22N4O2/c1-15-6-7-19-22-16(13-24(19)12-15)14-26-18-5-3-2-4-17(18)20(25)23-10-8-21-9-11-23/h2-7,12-13,21H,8-11,14H2,1H3 |
| InChIKey | LHDOGYSVMYXFMN-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 58.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [2-[(6-methylimidazo[1,2-a]pyridin-2-yl)methoxy]phenyl]-piperazin-1-ylmethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[(6-methylimidazo[1,2-a]pyridin-2-yl)methoxy]phenyl]-piperazin-1-ylmethanone?
The IUPAC name of [2-[(6-methylimidazo[1,2-a]pyridin-2-yl)methoxy]phenyl]-piperazin-1-ylmethanone (CID 119402980) is [2-[(6-methylimidazo[1,2-a]pyridin-2-yl)methoxy]phenyl]-piperazin-1-ylmethanone.
What is the SMILES notation for [2-[(6-methylimidazo[1,2-a]pyridin-2-yl)methoxy]phenyl]-piperazin-1-ylmethanone?
The canonical SMILES for [2-[(6-methylimidazo[1,2-a]pyridin-2-yl)methoxy]phenyl]-piperazin-1-ylmethanone is Cc1ccc2nc(COc3ccccc3C(=O)N3CCNCC3)cn2c1.
What is the InChIKey of [2-[(6-methylimidazo[1,2-a]pyridin-2-yl)methoxy]phenyl]-piperazin-1-ylmethanone?
The InChIKey is LHDOGYSVMYXFMN-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H22N4O2/c1-15-6-7-19-22-16(13-24(19)12-15)14-26-18-5-3-2-4-17(18)20(25)23-10-8-21-9-11-23/h2-7,12-13,21H,8-11,14H2,1H3.
What are the key properties of [2-[(6-methylimidazo[1,2-a]pyridin-2-yl)methoxy]phenyl]-piperazin-1-ylmethanone?
[2-[(6-methylimidazo[1,2-a]pyridin-2-yl)methoxy]phenyl]-piperazin-1-ylmethanone has a molecular weight of 350.42 g/mol, XLogP of 2.27, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[(6-methylimidazo[1,2-a]pyridin-2-yl)methoxy]phenyl]-piperazin-1-ylmethanone is sourced from PubChem (CID 119402980), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).