C21H31N3O2 — CID 11940393
2-[[2-[(4aR,8aS)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]acetyl]amino]-N-(2,3-dimethylphenyl)acetamide (PubChem CID 11940393) has the molecular formula C21H31N3O2 and a molecular weight of 357.50 g/mol. Its IUPAC name is 2-[[2-[(4aR,8aS)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]acetyl]amino]-N-(2,3-dimethylphenyl)acetamide.
| Compound Name | 2-[[2-[(4aR,8aS)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]acetyl]amino]-N-(2,3-dimethylphenyl)acetamide |
|---|---|
| PubChem CID | 11940393 |
| Molecular Formula | C21H31N3O2 |
| Molecular Weight | 357.50 g/mol |
| Exact Mass | 357.24 |
| IUPAC Name | 2-[[2-[(4aR,8aS)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]acetyl]amino]-N-(2,3-dimethylphenyl)acetamide |
| SMILES | Cc1cccc(NC(=O)CNC(=O)CN2CC[C@H]3CCCC[C@@H]3C2)c1C |
| InChI | InChI=1S/C21H31N3O2/c1-15-6-5-9-19(16(15)2)23-20(25)12-22-21(26)14-24-11-10-17-7-3-4-8-18(17)13-24/h5-6,9,17-18H,3-4,7-8,10-14H2,1-2H3,(H,22,26)(H,23,25)/t17-,18-/m1/s1 |
| InChIKey | JJQBFXWAXBFIDN-QZTJIDSGSA-N |
| XLogP | 2.87 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.50 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |