About N-(3-aminopropyl)-4,6-dimethoxypyrimidine-5-carboxamide
N-(3-aminopropyl)-4,6-dimethoxypyrimidine-5-carboxamide (PubChem CID 119406242) has the molecular formula C10H16N4O3
and a molecular weight of 240.26 g/mol. Its IUPAC name is N-(3-aminopropyl)-4,6-dimethoxypyrimidine-5-carboxamide.
Molecular Properties
| Compound Name | N-(3-aminopropyl)-4,6-dimethoxypyrimidine-5-carboxamide |
| PubChem CID | 119406242 |
| Molecular Formula | C10H16N4O3 |
| Molecular Weight | 240.26 g/mol |
| Exact Mass | 240.12 |
| IUPAC Name | N-(3-aminopropyl)-4,6-dimethoxypyrimidine-5-carboxamide |
| SMILES | COc1ncnc(OC)c1C(=O)NCCCN |
| InChI | InChI=1S/C10H16N4O3/c1-16-9-7(8(15)12-5-3-4-11)10(17-2)14-6-13-9/h6H,3-5,11H2,1-2H3,(H,12,15) |
| InChIKey | PKVDERABBIVWNN-UHFFFAOYSA-N |
| XLogP | -0.43 |
| TPSA | 99.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.26 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-(3-aminopropyl)-4,6-dimethoxypyrimidine-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-aminopropyl)-4,6-dimethoxypyrimidine-5-carboxamide?
The IUPAC name of N-(3-aminopropyl)-4,6-dimethoxypyrimidine-5-carboxamide (CID 119406242) is N-(3-aminopropyl)-4,6-dimethoxypyrimidine-5-carboxamide.
What is the SMILES notation for N-(3-aminopropyl)-4,6-dimethoxypyrimidine-5-carboxamide?
The canonical SMILES for N-(3-aminopropyl)-4,6-dimethoxypyrimidine-5-carboxamide is COc1ncnc(OC)c1C(=O)NCCCN.
What is the InChIKey of N-(3-aminopropyl)-4,6-dimethoxypyrimidine-5-carboxamide?
The InChIKey is PKVDERABBIVWNN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16N4O3/c1-16-9-7(8(15)12-5-3-4-11)10(17-2)14-6-13-9/h6H,3-5,11H2,1-2H3,(H,12,15).
What are the key properties of N-(3-aminopropyl)-4,6-dimethoxypyrimidine-5-carboxamide?
N-(3-aminopropyl)-4,6-dimethoxypyrimidine-5-carboxamide has a molecular weight of 240.26 g/mol, XLogP of -0.43, 6 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-aminopropyl)-4,6-dimethoxypyrimidine-5-carboxamide is sourced from PubChem (CID 119406242), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).