C13H24ClN3O2S — CID 119406281
N-(3-aminopropyl)-3-(cyclopentanecarbonyl)-1,3-thiazolidine-4-carboxamide;hydrochloride (PubChem CID 119406281) has the molecular formula C13H24ClN3O2S and a molecular weight of 321.87 g/mol. Its IUPAC name is N-(3-aminopropyl)-3-(cyclopentanecarbonyl)-1,3-thiazolidine-4-carboxamide;hydrochloride.
| Compound Name | N-(3-aminopropyl)-3-(cyclopentanecarbonyl)-1,3-thiazolidine-4-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119406281 |
| Molecular Formula | C13H24ClN3O2S |
| Molecular Weight | 321.87 g/mol |
| Exact Mass | 321.13 |
| IUPAC Name | N-(3-aminopropyl)-3-(cyclopentanecarbonyl)-1,3-thiazolidine-4-carboxamide;hydrochloride |
| SMILES | Cl.NCCCNC(=O)C1CSCN1C(=O)C1CCCC1 |
| InChI | InChI=1S/C13H23N3O2S.ClH/c14-6-3-7-15-12(17)11-8-19-9-16(11)13(18)10-4-1-2-5-10;/h10-11H,1-9,14H2,(H,15,17);1H |
| InChIKey | CDMRNHHVNGOIFH-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.87 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|