C20H24N2O2 — CID 119406404
N-(3-aminopropyl)-2-(4-phenylmethoxyphenyl)cyclopropane-1-carboxamide (PubChem CID 119406404) has the molecular formula C20H24N2O2 and a molecular weight of 324.42 g/mol. Its IUPAC name is N-(3-aminopropyl)-2-(4-phenylmethoxyphenyl)cyclopropane-1-carboxamide.
| Compound Name | N-(3-aminopropyl)-2-(4-phenylmethoxyphenyl)cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 119406404 |
| Molecular Formula | C20H24N2O2 |
| Molecular Weight | 324.42 g/mol |
| Exact Mass | 324.18 |
| IUPAC Name | N-(3-aminopropyl)-2-(4-phenylmethoxyphenyl)cyclopropane-1-carboxamide |
| SMILES | NCCCNC(=O)C1CC1c1ccc(OCc2ccccc2)cc1 |
| InChI | InChI=1S/C20H24N2O2/c21-11-4-12-22-20(23)19-13-18(19)16-7-9-17(10-8-16)24-14-15-5-2-1-3-6-15/h1-3,5-10,18-19H,4,11-14,21H2,(H,22,23) |
| InChIKey | RYZJBSLEBPLPBY-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.42 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|