C16H19ClF2N4O — CID 119407715
N-(3-aminopropyl)-1-(3,4-difluorophenyl)-5,6-dihydro-4H-cyclopenta[d]pyrazole-3-carboxamide;hydrochloride (PubChem CID 119407715) has the molecular formula C16H19ClF2N4O and a molecular weight of 356.80 g/mol. Its IUPAC name is N-(3-aminopropyl)-1-(3,4-difluorophenyl)-5,6-dihydro-4H-cyclopenta[d]pyrazole-3-carboxamide;hydrochloride.
| Compound Name | N-(3-aminopropyl)-1-(3,4-difluorophenyl)-5,6-dihydro-4H-cyclopenta[d]pyrazole-3-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119407715 |
| Molecular Formula | C16H19ClF2N4O |
| Molecular Weight | 356.80 g/mol |
| Exact Mass | 356.12 |
| IUPAC Name | N-(3-aminopropyl)-1-(3,4-difluorophenyl)-5,6-dihydro-4H-cyclopenta[d]pyrazole-3-carboxamide;hydrochloride |
| SMILES | Cl.NCCCNC(=O)c1nn(-c2ccc(F)c(F)c2)c2c1CCC2 |
| InChI | InChI=1S/C16H18F2N4O.ClH/c17-12-6-5-10(9-13(12)18)22-14-4-1-3-11(14)15(21-22)16(23)20-8-2-7-19;/h5-6,9H,1-4,7-8,19H2,(H,20,23);1H |
| InChIKey | AYDVXGYSEWRZNI-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.80 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|