C14H22ClFN2O — CID 119408534
N-(3-aminopropyl)-4-(3-fluorophenyl)-3-methylbutanamide;hydrochloride (PubChem CID 119408534) has the molecular formula C14H22ClFN2O and a molecular weight of 288.79 g/mol. Its IUPAC name is N-(3-aminopropyl)-4-(3-fluorophenyl)-3-methylbutanamide;hydrochloride.
| Compound Name | N-(3-aminopropyl)-4-(3-fluorophenyl)-3-methylbutanamide;hydrochloride |
|---|---|
| PubChem CID | 119408534 |
| Molecular Formula | C14H22ClFN2O |
| Molecular Weight | 288.79 g/mol |
| Exact Mass | 288.14 |
| IUPAC Name | N-(3-aminopropyl)-4-(3-fluorophenyl)-3-methylbutanamide;hydrochloride |
| SMILES | CC(CC(=O)NCCCN)Cc1cccc(F)c1.Cl |
| InChI | InChI=1S/C14H21FN2O.ClH/c1-11(9-14(18)17-7-3-6-16)8-12-4-2-5-13(15)10-12;/h2,4-5,10-11H,3,6-9,16H2,1H3,(H,17,18);1H |
| InChIKey | HFLSWDCBEVYIEM-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.79 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|