C15H20N4O — CID 119408817
N-(3-aminopropyl)-4-(3,5-dimethylpyrazol-1-yl)benzamide (PubChem CID 119408817) has the molecular formula C15H20N4O and a molecular weight of 272.35 g/mol. Its IUPAC name is N-(3-aminopropyl)-4-(3,5-dimethylpyrazol-1-yl)benzamide.
| Compound Name | N-(3-aminopropyl)-4-(3,5-dimethylpyrazol-1-yl)benzamide |
|---|---|
| PubChem CID | 119408817 |
| Molecular Formula | C15H20N4O |
| Molecular Weight | 272.35 g/mol |
| Exact Mass | 272.16 |
| IUPAC Name | N-(3-aminopropyl)-4-(3,5-dimethylpyrazol-1-yl)benzamide |
| SMILES | Cc1cc(C)n(-c2ccc(C(=O)NCCCN)cc2)n1 |
| InChI | InChI=1S/C15H20N4O/c1-11-10-12(2)19(18-11)14-6-4-13(5-7-14)15(20)17-9-3-8-16/h4-7,10H,3,8-9,16H2,1-2H3,(H,17,20) |
| InChIKey | NHVKXRNJNUCSLE-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.35 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|