C22H20N2O2S — CID 1194097
3-benzyl-5-(4-ethoxyphenyl)-6-methylthieno[2,3-d]pyrimidin-4-one (PubChem CID 1194097) has the molecular formula C22H20N2O2S and a molecular weight of 376.48 g/mol. Its IUPAC name is 3-benzyl-5-(4-ethoxyphenyl)-6-methylthieno[2,3-d]pyrimidin-4-one.
| Compound Name | 3-benzyl-5-(4-ethoxyphenyl)-6-methylthieno[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 1194097 |
| Molecular Formula | C22H20N2O2S |
| Molecular Weight | 376.48 g/mol |
| Exact Mass | 376.12 |
| IUPAC Name | 3-benzyl-5-(4-ethoxyphenyl)-6-methylthieno[2,3-d]pyrimidin-4-one |
| SMILES | CCOc1ccc(-c2c(C)sc3ncn(Cc4ccccc4)c(=O)c23)cc1 |
| InChI | InChI=1S/C22H20N2O2S/c1-3-26-18-11-9-17(10-12-18)19-15(2)27-21-20(19)22(25)24(14-23-21)13-16-7-5-4-6-8-16/h4-12,14H,3,13H2,1-2H3 |
| InChIKey | VYRORPGJSIHQQO-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.48 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |