C15H18ClN3O3 — CID 119410513
2-[2-[(3R)-3-aminopyrrolidin-1-yl]-2-oxoethyl]-5-methylisoindole-1,3-dione;hydrochloride (PubChem CID 119410513) has the molecular formula C15H18ClN3O3 and a molecular weight of 323.78 g/mol. Its IUPAC name is 2-[2-[(3R)-3-aminopyrrolidin-1-yl]-2-oxoethyl]-5-methylisoindole-1,3-dione;hydrochloride.
| Compound Name | 2-[2-[(3R)-3-aminopyrrolidin-1-yl]-2-oxoethyl]-5-methylisoindole-1,3-dione;hydrochloride |
|---|---|
| PubChem CID | 119410513 |
| Molecular Formula | C15H18ClN3O3 |
| Molecular Weight | 323.78 g/mol |
| Exact Mass | 323.10 |
| IUPAC Name | 2-[2-[(3R)-3-aminopyrrolidin-1-yl]-2-oxoethyl]-5-methylisoindole-1,3-dione;hydrochloride |
| SMILES | Cc1ccc2c(c1)C(=O)N(CC(=O)N1CC[C@@H](N)C1)C2=O.Cl |
| InChI | InChI=1S/C15H17N3O3.ClH/c1-9-2-3-11-12(6-9)15(21)18(14(11)20)8-13(19)17-5-4-10(16)7-17;/h2-3,6,10H,4-5,7-8,16H2,1H3;1H/t10-;/m1./s1 |
| InChIKey | PBPOMGSPJMRUPQ-HNCPQSOCSA-N |
| XLogP | 0.57 |
| TPSA | 83.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.78 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|