C21H28ClN3O3S — CID 11941255
(3aS,4R,5R,7R,7aR)-2-(4-chlorophenyl)imino-3-(cyclohexylmethyl)-4,5-dihydroxy-3a,4,5,6,7,7a-hexahydro-1,3-benzothiazole-7-carboxamide (PubChem CID 11941255) has the molecular formula C21H28ClN3O3S and a molecular weight of 437.99 g/mol. Its IUPAC name is (3aS,4R,5R,7R,7aR)-2-(4-chlorophenyl)imino-3-(cyclohexylmethyl)-4,5-dihydroxy-3a,4,5,6,7,7a-hexahydro-1,3-benzothiazole-7-carboxamide.
| Compound Name | (3aS,4R,5R,7R,7aR)-2-(4-chlorophenyl)imino-3-(cyclohexylmethyl)-4,5-dihydroxy-3a,4,5,6,7,7a-hexahydro-1,3-benzothiazole-7-carboxamide |
|---|---|
| PubChem CID | 11941255 |
| Molecular Formula | C21H28ClN3O3S |
| Molecular Weight | 437.99 g/mol |
| Exact Mass | 437.15 |
| IUPAC Name | (3aS,4R,5R,7R,7aR)-2-(4-chlorophenyl)imino-3-(cyclohexylmethyl)-4,5-dihydroxy-3a,4,5,6,7,7a-hexahydro-1,3-benzothiazole-7-carboxamide |
| SMILES | NC(=O)[C@H]1C[C@@H](O)[C@H](O)[C@H]2[C@@H]1S/C(=N\c1ccc(Cl)cc1)N2CC1CCCCC1 |
| InChI | InChI=1S/C21H28ClN3O3S/c22-13-6-8-14(9-7-13)24-21-25(11-12-4-2-1-3-5-12)17-18(27)16(26)10-15(20(23)28)19(17)29-21/h6-9,12,15-19,26-27H,1-5,10-11H2,(H2,23,28)/b24-21-/t15-,16+,17-,18-,19+/m0/s1 |
| InChIKey | BMDNEKFOOIBWGI-ZJQYEIQWSA-N |
| XLogP | 2.92 |
| TPSA | 99.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.99 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|