C21H25N3O5S — CID 11941287
(3aS,4R,5R,7R,7aR)-2-(furan-2-ylmethylimino)-4,5-dihydroxy-3-[(4-methoxyphenyl)methyl]-3a,4,5,6,7,7a-hexahydro-1,3-benzothiazole-7-carboxamide (PubChem CID 11941287) has the molecular formula C21H25N3O5S and a molecular weight of 431.51 g/mol. Its IUPAC name is (3aS,4R,5R,7R,7aR)-2-(furan-2-ylmethylimino)-4,5-dihydroxy-3-[(4-methoxyphenyl)methyl]-3a,4,5,6,7,7a-hexahydro-1,3-benzothiazole-7-carboxamide.
| Compound Name | (3aS,4R,5R,7R,7aR)-2-(furan-2-ylmethylimino)-4,5-dihydroxy-3-[(4-methoxyphenyl)methyl]-3a,4,5,6,7,7a-hexahydro-1,3-benzothiazole-7-carboxamide |
|---|---|
| PubChem CID | 11941287 |
| Molecular Formula | C21H25N3O5S |
| Molecular Weight | 431.51 g/mol |
| Exact Mass | 431.15 |
| IUPAC Name | (3aS,4R,5R,7R,7aR)-2-(furan-2-ylmethylimino)-4,5-dihydroxy-3-[(4-methoxyphenyl)methyl]-3a,4,5,6,7,7a-hexahydro-1,3-benzothiazole-7-carboxamide |
| SMILES | COc1ccc(CN2/C(=N/Cc3ccco3)S[C@H]3[C@@H]2[C@@H](O)[C@H](O)C[C@@H]3C(N)=O)cc1 |
| InChI | InChI=1S/C21H25N3O5S/c1-28-13-6-4-12(5-7-13)11-24-17-18(26)16(25)9-15(20(22)27)19(17)30-21(24)23-10-14-3-2-8-29-14/h2-8,15-19,25-26H,9-11H2,1H3,(H2,22,27)/b23-21-/t15-,16+,17-,18-,19+/m0/s1 |
| InChIKey | OQKSXSNCLJQKAQ-GJZTYRRGSA-N |
| XLogP | 1.36 |
| TPSA | 121.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.51 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|