C17H23N3O3 — CID 119413472
4-[(3R)-3-aminopyrrolidine-1-carbonyl]-1-[(4-methoxyphenyl)methyl]pyrrolidin-2-one (PubChem CID 119413472) has the molecular formula C17H23N3O3 and a molecular weight of 317.39 g/mol. Its IUPAC name is 4-[(3R)-3-aminopyrrolidine-1-carbonyl]-1-[(4-methoxyphenyl)methyl]pyrrolidin-2-one.
| Compound Name | 4-[(3R)-3-aminopyrrolidine-1-carbonyl]-1-[(4-methoxyphenyl)methyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 119413472 |
| Molecular Formula | C17H23N3O3 |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.17 |
| IUPAC Name | 4-[(3R)-3-aminopyrrolidine-1-carbonyl]-1-[(4-methoxyphenyl)methyl]pyrrolidin-2-one |
| SMILES | COc1ccc(CN2CC(C(=O)N3CC[C@@H](N)C3)CC2=O)cc1 |
| InChI | InChI=1S/C17H23N3O3/c1-23-15-4-2-12(3-5-15)9-20-10-13(8-16(20)21)17(22)19-7-6-14(18)11-19/h2-5,13-14H,6-11,18H2,1H3/t13?,14-/m1/s1 |
| InChIKey | AJSXAJUOOOVMLJ-ARLHGKGLSA-N |
| XLogP | 0.60 |
| TPSA | 75.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |