C10H14BrClN2O2 — CID 119413838
(3-bromofuran-2-yl)-[3-(methylamino)pyrrolidin-1-yl]methanone;hydrochloride (PubChem CID 119413838) has the molecular formula C10H14BrClN2O2 and a molecular weight of 309.59 g/mol. Its IUPAC name is (3-bromofuran-2-yl)-[3-(methylamino)pyrrolidin-1-yl]methanone;hydrochloride.
| Compound Name | (3-bromofuran-2-yl)-[3-(methylamino)pyrrolidin-1-yl]methanone;hydrochloride |
|---|---|
| PubChem CID | 119413838 |
| Molecular Formula | C10H14BrClN2O2 |
| Molecular Weight | 309.59 g/mol |
| Exact Mass | 307.99 |
| IUPAC Name | (3-bromofuran-2-yl)-[3-(methylamino)pyrrolidin-1-yl]methanone;hydrochloride |
| SMILES | CNC1CCN(C(=O)c2occc2Br)C1.Cl |
| InChI | InChI=1S/C10H13BrN2O2.ClH/c1-12-7-2-4-13(6-7)10(14)9-8(11)3-5-15-9;/h3,5,7,12H,2,4,6H2,1H3;1H |
| InChIKey | FYKUFRLXOILFJD-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 45.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.59 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |