C15H17F3N4O2S — CID 1194146
5-[1-[2-(dimethylamino)ethyl]-2-methyl-6-(trifluoromethyl)-4-pyridinylidene]-2-sulfanylidene-1,3-diazinane-4,6-dione (PubChem CID 1194146) has the molecular formula C15H17F3N4O2S and a molecular weight of 374.39 g/mol. Its IUPAC name is 5-[1-[2-(dimethylamino)ethyl]-2-methyl-6-(trifluoromethyl)-4-pyridinylidene]-2-sulfanylidene-1,3-diazinane-4,6-dione.
| Compound Name | 5-[1-[2-(dimethylamino)ethyl]-2-methyl-6-(trifluoromethyl)-4-pyridinylidene]-2-sulfanylidene-1,3-diazinane-4,6-dione |
|---|---|
| PubChem CID | 1194146 |
| Molecular Formula | C15H17F3N4O2S |
| Molecular Weight | 374.39 g/mol |
| Exact Mass | 374.10 |
| IUPAC Name | 5-[1-[2-(dimethylamino)ethyl]-2-methyl-6-(trifluoromethyl)-4-pyridinylidene]-2-sulfanylidene-1,3-diazinane-4,6-dione |
| SMILES | CC1=CC(=C2C(=O)NC(=S)NC2=O)C=C(C(F)(F)F)N1CCN(C)C |
| InChI | InChI=1S/C15H17F3N4O2S/c1-8-6-9(11-12(23)19-14(25)20-13(11)24)7-10(15(16,17)18)22(8)5-4-21(2)3/h6-7H,4-5H2,1-3H3,(H2,19,20,23,24,25) |
| InChIKey | WKJODVMFQZJSAU-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.39 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|