C16H19F3N4O2S — CID 1194147
5-[1-[3-(dimethylamino)propyl]-2-methyl-6-(trifluoromethyl)-4-pyridinylidene]-2-sulfanylidene-1,3-diazinane-4,6-dione (PubChem CID 1194147) has the molecular formula C16H19F3N4O2S and a molecular weight of 388.42 g/mol. Its IUPAC name is 5-[1-[3-(dimethylamino)propyl]-2-methyl-6-(trifluoromethyl)-4-pyridinylidene]-2-sulfanylidene-1,3-diazinane-4,6-dione.
| Compound Name | 5-[1-[3-(dimethylamino)propyl]-2-methyl-6-(trifluoromethyl)-4-pyridinylidene]-2-sulfanylidene-1,3-diazinane-4,6-dione |
|---|---|
| PubChem CID | 1194147 |
| Molecular Formula | C16H19F3N4O2S |
| Molecular Weight | 388.42 g/mol |
| Exact Mass | 388.12 |
| IUPAC Name | 5-[1-[3-(dimethylamino)propyl]-2-methyl-6-(trifluoromethyl)-4-pyridinylidene]-2-sulfanylidene-1,3-diazinane-4,6-dione |
| SMILES | CC1=CC(=C2C(=O)NC(=S)NC2=O)C=C(C(F)(F)F)N1CCCN(C)C |
| InChI | InChI=1S/C16H19F3N4O2S/c1-9-7-10(12-13(24)20-15(26)21-14(12)25)8-11(16(17,18)19)23(9)6-4-5-22(2)3/h7-8H,4-6H2,1-3H3,(H2,20,21,24,25,26) |
| InChIKey | QNSHBYKXXVQWHB-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.42 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|