C18H20FN3O3S — CID 119414701
4-(1,4-diazepane-1-carbonyl)-N-(4-fluorophenyl)benzenesulfonamide (PubChem CID 119414701) has the molecular formula C18H20FN3O3S and a molecular weight of 377.44 g/mol. Its IUPAC name is 4-(1,4-diazepane-1-carbonyl)-N-(4-fluorophenyl)benzenesulfonamide.
| Compound Name | 4-(1,4-diazepane-1-carbonyl)-N-(4-fluorophenyl)benzenesulfonamide |
|---|---|
| PubChem CID | 119414701 |
| Molecular Formula | C18H20FN3O3S |
| Molecular Weight | 377.44 g/mol |
| Exact Mass | 377.12 |
| IUPAC Name | 4-(1,4-diazepane-1-carbonyl)-N-(4-fluorophenyl)benzenesulfonamide |
| SMILES | O=C(c1ccc(S(=O)(=O)Nc2ccc(F)cc2)cc1)N1CCCNCC1 |
| InChI | InChI=1S/C18H20FN3O3S/c19-15-4-6-16(7-5-15)21-26(24,25)17-8-2-14(3-9-17)18(23)22-12-1-10-20-11-13-22/h2-9,20-21H,1,10-13H2 |
| InChIKey | UCCYQEWYSXIMAY-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.44 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |