C16H24ClN3O4 — CID 119415175
2-[1-(1,4-diazepan-1-yl)-1-oxopropan-2-yl]-3a,4,5,6,7,7a-hexahydro-4,7-epoxyisoindole-1,3-dione;hydrochloride (PubChem CID 119415175) has the molecular formula C16H24ClN3O4 and a molecular weight of 357.84 g/mol. Its IUPAC name is 2-[1-(1,4-diazepan-1-yl)-1-oxopropan-2-yl]-3a,4,5,6,7,7a-hexahydro-4,7-epoxyisoindole-1,3-dione;hydrochloride.
| Compound Name | 2-[1-(1,4-diazepan-1-yl)-1-oxopropan-2-yl]-3a,4,5,6,7,7a-hexahydro-4,7-epoxyisoindole-1,3-dione;hydrochloride |
|---|---|
| PubChem CID | 119415175 |
| Molecular Formula | C16H24ClN3O4 |
| Molecular Weight | 357.84 g/mol |
| Exact Mass | 357.15 |
| IUPAC Name | 2-[1-(1,4-diazepan-1-yl)-1-oxopropan-2-yl]-3a,4,5,6,7,7a-hexahydro-4,7-epoxyisoindole-1,3-dione;hydrochloride |
| SMILES | CC(C(=O)N1CCCNCC1)N1C(=O)C2C3CCC(O3)C2C1=O.Cl |
| InChI | InChI=1S/C16H23N3O4.ClH/c1-9(14(20)18-7-2-5-17-6-8-18)19-15(21)12-10-3-4-11(23-10)13(12)16(19)22;/h9-13,17H,2-8H2,1H3;1H |
| InChIKey | SOEKMFQYBJKLQU-UHFFFAOYSA-N |
| XLogP | -0.22 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.84 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|