C24H23N3O4S2 — CID 11941551
N-[(6aS,7S)-2-(2,3-dimethylphenyl)-6,11-dioxo-6a,7,8,9-tetrahydro-5H-pyrrolo[2,1-c][1,4]benzodiazepin-7-yl]thiophene-2-sulfonamide (PubChem CID 11941551) has the molecular formula C24H23N3O4S2 and a molecular weight of 481.60 g/mol. Its IUPAC name is N-[(6aS,7S)-2-(2,3-dimethylphenyl)-6,11-dioxo-6a,7,8,9-tetrahydro-5H-pyrrolo[2,1-c][1,4]benzodiazepin-7-yl]thiophene-2-sulfonamide.
| Compound Name | N-[(6aS,7S)-2-(2,3-dimethylphenyl)-6,11-dioxo-6a,7,8,9-tetrahydro-5H-pyrrolo[2,1-c][1,4]benzodiazepin-7-yl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 11941551 |
| Molecular Formula | C24H23N3O4S2 |
| Molecular Weight | 481.60 g/mol |
| Exact Mass | 481.11 |
| IUPAC Name | N-[(6aS,7S)-2-(2,3-dimethylphenyl)-6,11-dioxo-6a,7,8,9-tetrahydro-5H-pyrrolo[2,1-c][1,4]benzodiazepin-7-yl]thiophene-2-sulfonamide |
| SMILES | Cc1cccc(-c2ccc3c(c2)C(=O)N2CC[C@H](NS(=O)(=O)c4cccs4)[C@H]2C(=O)N3)c1C |
| InChI | InChI=1S/C24H23N3O4S2/c1-14-5-3-6-17(15(14)2)16-8-9-19-18(13-16)24(29)27-11-10-20(22(27)23(28)25-19)26-33(30,31)21-7-4-12-32-21/h3-9,12-13,20,22,26H,10-11H2,1-2H3,(H,25,28)/t20-,22-/m0/s1 |
| InChIKey | GCHDDQYIRZASKX-UNMCSNQZSA-N |
| XLogP | 3.55 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.60 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |