About 3-(1,4-diazepane-1-carbonyl)-6-(trifluoromethyl)piperidin-2-one;hydrochloride
3-(1,4-diazepane-1-carbonyl)-6-(trifluoromethyl)piperidin-2-one;hydrochloride (PubChem CID 119417957) has the molecular formula C12H19ClF3N3O2
and a molecular weight of 329.75 g/mol. Its IUPAC name is 3-(1,4-diazepane-1-carbonyl)-6-(trifluoromethyl)piperidin-2-one;hydrochloride.
Molecular Properties
| Compound Name | 3-(1,4-diazepane-1-carbonyl)-6-(trifluoromethyl)piperidin-2-one;hydrochloride |
| PubChem CID | 119417957 |
| Molecular Formula | C12H19ClF3N3O2 |
| Molecular Weight | 329.75 g/mol |
| Exact Mass | 329.11 |
| IUPAC Name | 3-(1,4-diazepane-1-carbonyl)-6-(trifluoromethyl)piperidin-2-one;hydrochloride |
| SMILES | Cl.O=C1NC(C(F)(F)F)CCC1C(=O)N1CCCNCC1 |
| InChI | InChI=1S/C12H18F3N3O2.ClH/c13-12(14,15)9-3-2-8(10(19)17-9)11(20)18-6-1-4-16-5-7-18;/h8-9,16H,1-7H2,(H,17,19);1H |
| InChIKey | IZPWQOHDYIUFAC-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.75 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 3-(1,4-diazepane-1-carbonyl)-6-(trifluoromethyl)piperidin-2-one;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1,4-diazepane-1-carbonyl)-6-(trifluoromethyl)piperidin-2-one;hydrochloride?
The IUPAC name of 3-(1,4-diazepane-1-carbonyl)-6-(trifluoromethyl)piperidin-2-one;hydrochloride (CID 119417957) is 3-(1,4-diazepane-1-carbonyl)-6-(trifluoromethyl)piperidin-2-one;hydrochloride.
What is the SMILES notation for 3-(1,4-diazepane-1-carbonyl)-6-(trifluoromethyl)piperidin-2-one;hydrochloride?
The canonical SMILES for 3-(1,4-diazepane-1-carbonyl)-6-(trifluoromethyl)piperidin-2-one;hydrochloride is Cl.O=C1NC(C(F)(F)F)CCC1C(=O)N1CCCNCC1.
What is the InChIKey of 3-(1,4-diazepane-1-carbonyl)-6-(trifluoromethyl)piperidin-2-one;hydrochloride?
The InChIKey is IZPWQOHDYIUFAC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18F3N3O2.ClH/c13-12(14,15)9-3-2-8(10(19)17-9)11(20)18-6-1-4-16-5-7-18;/h8-9,16H,1-7H2,(H,17,19);1H.
What are the key properties of 3-(1,4-diazepane-1-carbonyl)-6-(trifluoromethyl)piperidin-2-one;hydrochloride?
3-(1,4-diazepane-1-carbonyl)-6-(trifluoromethyl)piperidin-2-one;hydrochloride has a molecular weight of 329.75 g/mol, XLogP of 0.69, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1,4-diazepane-1-carbonyl)-6-(trifluoromethyl)piperidin-2-one;hydrochloride is sourced from PubChem (CID 119417957), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).