C19H24N4O — CID 119418185
1-(1,4-diazepan-1-yl)-2-[N-(pyridin-3-ylmethyl)anilino]ethanone (PubChem CID 119418185) has the molecular formula C19H24N4O and a molecular weight of 324.43 g/mol. Its IUPAC name is 1-(1,4-diazepan-1-yl)-2-[N-(pyridin-3-ylmethyl)anilino]ethanone.
| Compound Name | 1-(1,4-diazepan-1-yl)-2-[N-(pyridin-3-ylmethyl)anilino]ethanone |
|---|---|
| PubChem CID | 119418185 |
| Molecular Formula | C19H24N4O |
| Molecular Weight | 324.43 g/mol |
| Exact Mass | 324.20 |
| IUPAC Name | 1-(1,4-diazepan-1-yl)-2-[N-(pyridin-3-ylmethyl)anilino]ethanone |
| SMILES | O=C(CN(Cc1cccnc1)c1ccccc1)N1CCCNCC1 |
| InChI | InChI=1S/C19H24N4O/c24-19(22-12-5-10-20-11-13-22)16-23(18-7-2-1-3-8-18)15-17-6-4-9-21-14-17/h1-4,6-9,14,20H,5,10-13,15-16H2 |
| InChIKey | XJBVXKSIEPRRNZ-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.43 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |