C21H33N3O2 — CID 119418511
4-tert-butyl-N-[1-(1,4-diazepan-1-yl)-3-methyl-1-oxobutan-2-yl]benzamide (PubChem CID 119418511) has the molecular formula C21H33N3O2 and a molecular weight of 359.51 g/mol. Its IUPAC name is 4-tert-butyl-N-[1-(1,4-diazepan-1-yl)-3-methyl-1-oxobutan-2-yl]benzamide.
| Compound Name | 4-tert-butyl-N-[1-(1,4-diazepan-1-yl)-3-methyl-1-oxobutan-2-yl]benzamide |
|---|---|
| PubChem CID | 119418511 |
| Molecular Formula | C21H33N3O2 |
| Molecular Weight | 359.51 g/mol |
| Exact Mass | 359.26 |
| IUPAC Name | 4-tert-butyl-N-[1-(1,4-diazepan-1-yl)-3-methyl-1-oxobutan-2-yl]benzamide |
| SMILES | CC(C)C(NC(=O)c1ccc(C(C)(C)C)cc1)C(=O)N1CCCNCC1 |
| InChI | InChI=1S/C21H33N3O2/c1-15(2)18(20(26)24-13-6-11-22-12-14-24)23-19(25)16-7-9-17(10-8-16)21(3,4)5/h7-10,15,18,22H,6,11-14H2,1-5H3,(H,23,25) |
| InChIKey | XRLAAGUWLUDBBH-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.51 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |