C19H23ClN4O3 — CID 119419296
N-(3-amino-4-methoxyphenyl)-5-(tert-butylcarbamoylamino)-2-chlorobenzamide (PubChem CID 119419296) has the molecular formula C19H23ClN4O3 and a molecular weight of 390.87 g/mol. Its IUPAC name is N-(3-amino-4-methoxyphenyl)-5-(tert-butylcarbamoylamino)-2-chlorobenzamide.
| Compound Name | N-(3-amino-4-methoxyphenyl)-5-(tert-butylcarbamoylamino)-2-chlorobenzamide |
|---|---|
| PubChem CID | 119419296 |
| Molecular Formula | C19H23ClN4O3 |
| Molecular Weight | 390.87 g/mol |
| Exact Mass | 390.15 |
| IUPAC Name | N-(3-amino-4-methoxyphenyl)-5-(tert-butylcarbamoylamino)-2-chlorobenzamide |
| SMILES | COc1ccc(NC(=O)c2cc(NC(=O)NC(C)(C)C)ccc2Cl)cc1N |
| InChI | InChI=1S/C19H23ClN4O3/c1-19(2,3)24-18(26)23-11-5-7-14(20)13(9-11)17(25)22-12-6-8-16(27-4)15(21)10-12/h5-10H,21H2,1-4H3,(H,22,25)(H2,23,24,26) |
| InChIKey | UKSDEHXYHJPAMD-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 105.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.87 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|