C19H20ClN3O4 — CID 119419417
N-(3-amino-4-methoxyphenyl)-1-(5-chloro-2-methoxyphenyl)-5-oxopyrrolidine-3-carboxamide (PubChem CID 119419417) has the molecular formula C19H20ClN3O4 and a molecular weight of 389.84 g/mol. Its IUPAC name is N-(3-amino-4-methoxyphenyl)-1-(5-chloro-2-methoxyphenyl)-5-oxopyrrolidine-3-carboxamide.
| Compound Name | N-(3-amino-4-methoxyphenyl)-1-(5-chloro-2-methoxyphenyl)-5-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 119419417 |
| Molecular Formula | C19H20ClN3O4 |
| Molecular Weight | 389.84 g/mol |
| Exact Mass | 389.11 |
| IUPAC Name | N-(3-amino-4-methoxyphenyl)-1-(5-chloro-2-methoxyphenyl)-5-oxopyrrolidine-3-carboxamide |
| SMILES | COc1ccc(NC(=O)C2CC(=O)N(c3cc(Cl)ccc3OC)C2)cc1N |
| InChI | InChI=1S/C19H20ClN3O4/c1-26-16-6-4-13(9-14(16)21)22-19(25)11-7-18(24)23(10-11)15-8-12(20)3-5-17(15)27-2/h3-6,8-9,11H,7,10,21H2,1-2H3,(H,22,25) |
| InChIKey | ZKZJYBFYEKFBOG-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 93.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.84 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|