C20H26ClN3O4 — CID 119419483
3-acetamido-N-(3-amino-4-methoxyphenyl)-3-(2-ethoxyphenyl)propanamide;hydrochloride (PubChem CID 119419483) has the molecular formula C20H26ClN3O4 and a molecular weight of 407.90 g/mol. Its IUPAC name is 3-acetamido-N-(3-amino-4-methoxyphenyl)-3-(2-ethoxyphenyl)propanamide;hydrochloride.
| Compound Name | 3-acetamido-N-(3-amino-4-methoxyphenyl)-3-(2-ethoxyphenyl)propanamide;hydrochloride |
|---|---|
| PubChem CID | 119419483 |
| Molecular Formula | C20H26ClN3O4 |
| Molecular Weight | 407.90 g/mol |
| Exact Mass | 407.16 |
| IUPAC Name | 3-acetamido-N-(3-amino-4-methoxyphenyl)-3-(2-ethoxyphenyl)propanamide;hydrochloride |
| SMILES | CCOc1ccccc1C(CC(=O)Nc1ccc(OC)c(N)c1)NC(C)=O.Cl |
| InChI | InChI=1S/C20H25N3O4.ClH/c1-4-27-18-8-6-5-7-15(18)17(22-13(2)24)12-20(25)23-14-9-10-19(26-3)16(21)11-14;/h5-11,17H,4,12,21H2,1-3H3,(H,22,24)(H,23,25);1H |
| InChIKey | OPLYPFPPDIVLHG-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 102.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.90 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|