C15H17Cl3N2O2S — CID 119421686
N-(2-amino-5-methoxyphenyl)-4-(2,5-dichlorothiophen-3-yl)butanamide;hydrochloride (PubChem CID 119421686) has the molecular formula C15H17Cl3N2O2S and a molecular weight of 395.74 g/mol. Its IUPAC name is N-(2-amino-5-methoxyphenyl)-4-(2,5-dichlorothiophen-3-yl)butanamide;hydrochloride.
| Compound Name | N-(2-amino-5-methoxyphenyl)-4-(2,5-dichlorothiophen-3-yl)butanamide;hydrochloride |
|---|---|
| PubChem CID | 119421686 |
| Molecular Formula | C15H17Cl3N2O2S |
| Molecular Weight | 395.74 g/mol |
| Exact Mass | 394.01 |
| IUPAC Name | N-(2-amino-5-methoxyphenyl)-4-(2,5-dichlorothiophen-3-yl)butanamide;hydrochloride |
| SMILES | COc1ccc(N)c(NC(=O)CCCc2cc(Cl)sc2Cl)c1.Cl |
| InChI | InChI=1S/C15H16Cl2N2O2S.ClH/c1-21-10-5-6-11(18)12(8-10)19-14(20)4-2-3-9-7-13(16)22-15(9)17;/h5-8H,2-4,18H2,1H3,(H,19,20);1H |
| InChIKey | LZDFLDXWYRNDQI-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.74 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|