C18H23Cl2N5O — CID 119422061
N-(2-aminophenyl)-1-butan-2-yl-6-methylpyrazolo[3,4-b]pyridine-4-carboxamide;dihydrochloride (PubChem CID 119422061) has the molecular formula C18H23Cl2N5O and a molecular weight of 396.32 g/mol. Its IUPAC name is N-(2-aminophenyl)-1-butan-2-yl-6-methylpyrazolo[3,4-b]pyridine-4-carboxamide;dihydrochloride.
| Compound Name | N-(2-aminophenyl)-1-butan-2-yl-6-methylpyrazolo[3,4-b]pyridine-4-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 119422061 |
| Molecular Formula | C18H23Cl2N5O |
| Molecular Weight | 396.32 g/mol |
| Exact Mass | 395.13 |
| IUPAC Name | N-(2-aminophenyl)-1-butan-2-yl-6-methylpyrazolo[3,4-b]pyridine-4-carboxamide;dihydrochloride |
| SMILES | CCC(C)n1ncc2c(C(=O)Nc3ccccc3N)cc(C)nc21.Cl.Cl |
| InChI | InChI=1S/C18H21N5O.2ClH/c1-4-12(3)23-17-14(10-20-23)13(9-11(2)21-17)18(24)22-16-8-6-5-7-15(16)19;;/h5-10,12H,4,19H2,1-3H3,(H,22,24);2*1H |
| InChIKey | TWVRYEJILSCYAY-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.32 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|