C20H22ClN5O3 — CID 119422524
N-(2-aminophenyl)-7-cyclopropyl-2,4-dioxo-1-propylpyrido[2,3-d]pyrimidine-5-carboxamide;hydrochloride (PubChem CID 119422524) has the molecular formula C20H22ClN5O3 and a molecular weight of 415.88 g/mol. Its IUPAC name is N-(2-aminophenyl)-7-cyclopropyl-2,4-dioxo-1-propylpyrido[2,3-d]pyrimidine-5-carboxamide;hydrochloride.
| Compound Name | N-(2-aminophenyl)-7-cyclopropyl-2,4-dioxo-1-propylpyrido[2,3-d]pyrimidine-5-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119422524 |
| Molecular Formula | C20H22ClN5O3 |
| Molecular Weight | 415.88 g/mol |
| Exact Mass | 415.14 |
| IUPAC Name | N-(2-aminophenyl)-7-cyclopropyl-2,4-dioxo-1-propylpyrido[2,3-d]pyrimidine-5-carboxamide;hydrochloride |
| SMILES | CCCn1c(=O)[nH]c(=O)c2c(C(=O)Nc3ccccc3N)cc(C3CC3)nc21.Cl |
| InChI | InChI=1S/C20H21N5O3.ClH/c1-2-9-25-17-16(19(27)24-20(25)28)12(10-15(22-17)11-7-8-11)18(26)23-14-6-4-3-5-13(14)21;/h3-6,10-11H,2,7-9,21H2,1H3,(H,23,26)(H,24,27,28);1H |
| InChIKey | XXYNXDOSOAUYRU-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 122.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.88 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|