C23H20ClN3O4 — CID 1194234
N-(3-chloro-2-methylphenyl)-4-[2-[2-[(4-hydroxyphenyl)methylidene]hydrazinyl]-2-oxoethoxy]benzamide (PubChem CID 1194234) has the molecular formula C23H20ClN3O4 and a molecular weight of 437.88 g/mol. Its IUPAC name is N-(3-chloro-2-methylphenyl)-4-[2-[2-[(4-hydroxyphenyl)methylidene]hydrazinyl]-2-oxoethoxy]benzamide.
| Compound Name | N-(3-chloro-2-methylphenyl)-4-[2-[2-[(4-hydroxyphenyl)methylidene]hydrazinyl]-2-oxoethoxy]benzamide |
|---|---|
| PubChem CID | 1194234 |
| Molecular Formula | C23H20ClN3O4 |
| Molecular Weight | 437.88 g/mol |
| Exact Mass | 437.11 |
| IUPAC Name | N-(3-chloro-2-methylphenyl)-4-[2-[2-[(4-hydroxyphenyl)methylidene]hydrazinyl]-2-oxoethoxy]benzamide |
| SMILES | Cc1c(Cl)cccc1NC(=O)c1ccc(OCC(=O)NN=Cc2ccc(O)cc2)cc1 |
| InChI | InChI=1S/C23H20ClN3O4/c1-15-20(24)3-2-4-21(15)26-23(30)17-7-11-19(12-8-17)31-14-22(29)27-25-13-16-5-9-18(28)10-6-16/h2-13,28H,14H2,1H3,(H,26,30)(H,27,29) |
| InChIKey | CVUDNWWLAMQIGG-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 100.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.88 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|