C14H27ClN2O2 — CID 119423632
1-[4-(aminomethyl)piperidin-1-yl]-3-(5-methyloxolan-2-yl)propan-1-one;hydrochloride (PubChem CID 119423632) has the molecular formula C14H27ClN2O2 and a molecular weight of 290.83 g/mol. Its IUPAC name is 1-[4-(aminomethyl)piperidin-1-yl]-3-(5-methyloxolan-2-yl)propan-1-one;hydrochloride.
| Compound Name | 1-[4-(aminomethyl)piperidin-1-yl]-3-(5-methyloxolan-2-yl)propan-1-one;hydrochloride |
|---|---|
| PubChem CID | 119423632 |
| Molecular Formula | C14H27ClN2O2 |
| Molecular Weight | 290.83 g/mol |
| Exact Mass | 290.18 |
| IUPAC Name | 1-[4-(aminomethyl)piperidin-1-yl]-3-(5-methyloxolan-2-yl)propan-1-one;hydrochloride |
| SMILES | CC1CCC(CCC(=O)N2CCC(CN)CC2)O1.Cl |
| InChI | InChI=1S/C14H26N2O2.ClH/c1-11-2-3-13(18-11)4-5-14(17)16-8-6-12(10-15)7-9-16;/h11-13H,2-10,15H2,1H3;1H |
| InChIKey | HPGXDKRNVICDMI-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.83 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |