C14H21ClN2O3S — CID 119423969
[4-(aminomethyl)piperidin-1-yl]-(4-methylsulfonylphenyl)methanone;hydrochloride (PubChem CID 119423969) has the molecular formula C14H21ClN2O3S and a molecular weight of 332.85 g/mol. Its IUPAC name is [4-(aminomethyl)piperidin-1-yl]-(4-methylsulfonylphenyl)methanone;hydrochloride.
| Compound Name | [4-(aminomethyl)piperidin-1-yl]-(4-methylsulfonylphenyl)methanone;hydrochloride |
|---|---|
| PubChem CID | 119423969 |
| Molecular Formula | C14H21ClN2O3S |
| Molecular Weight | 332.85 g/mol |
| Exact Mass | 332.10 |
| IUPAC Name | [4-(aminomethyl)piperidin-1-yl]-(4-methylsulfonylphenyl)methanone;hydrochloride |
| SMILES | CS(=O)(=O)c1ccc(C(=O)N2CCC(CN)CC2)cc1.Cl |
| InChI | InChI=1S/C14H20N2O3S.ClH/c1-20(18,19)13-4-2-12(3-5-13)14(17)16-8-6-11(10-15)7-9-16;/h2-5,11H,6-10,15H2,1H3;1H |
| InChIKey | HLVRMXIZXIBHHK-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.85 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |