C19H26N2O2 — CID 119424316
2-(6-methyl-5-propan-2-yl-1-benzofuran-3-yl)-N-piperidin-3-ylacetamide (PubChem CID 119424316) has the molecular formula C19H26N2O2 and a molecular weight of 314.43 g/mol. Its IUPAC name is 2-(6-methyl-5-propan-2-yl-1-benzofuran-3-yl)-N-piperidin-3-ylacetamide.
| Compound Name | 2-(6-methyl-5-propan-2-yl-1-benzofuran-3-yl)-N-piperidin-3-ylacetamide |
|---|---|
| PubChem CID | 119424316 |
| Molecular Formula | C19H26N2O2 |
| Molecular Weight | 314.43 g/mol |
| Exact Mass | 314.20 |
| IUPAC Name | 2-(6-methyl-5-propan-2-yl-1-benzofuran-3-yl)-N-piperidin-3-ylacetamide |
| SMILES | Cc1cc2occ(CC(=O)NC3CCCNC3)c2cc1C(C)C |
| InChI | InChI=1S/C19H26N2O2/c1-12(2)16-9-17-14(11-23-18(17)7-13(16)3)8-19(22)21-15-5-4-6-20-10-15/h7,9,11-12,15,20H,4-6,8,10H2,1-3H3,(H,21,22) |
| InChIKey | YOBJIHRIBNWGCJ-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 54.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.43 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |