C22H30N6O3 — CID 11942491
(3R,4S,6R)-N-(2-acetamidoethyl)-6-[[4-(phenoxymethyl)triazol-1-yl]methyl]-1-azabicyclo[2.2.2]octane-3-carboxamide (PubChem CID 11942491) has the molecular formula C22H30N6O3 and a molecular weight of 426.52 g/mol. Its IUPAC name is (3R,4S,6R)-N-(2-acetamidoethyl)-6-[[4-(phenoxymethyl)triazol-1-yl]methyl]-1-azabicyclo[2.2.2]octane-3-carboxamide.
| Compound Name | (3R,4S,6R)-N-(2-acetamidoethyl)-6-[[4-(phenoxymethyl)triazol-1-yl]methyl]-1-azabicyclo[2.2.2]octane-3-carboxamide |
|---|---|
| PubChem CID | 11942491 |
| Molecular Formula | C22H30N6O3 |
| Molecular Weight | 426.52 g/mol |
| Exact Mass | 426.24 |
| IUPAC Name | (3R,4S,6R)-N-(2-acetamidoethyl)-6-[[4-(phenoxymethyl)triazol-1-yl]methyl]-1-azabicyclo[2.2.2]octane-3-carboxamide |
| SMILES | CC(=O)NCCNC(=O)[C@H]1CN2CC[C@H]1C[C@@H]2Cn1cc(COc2ccccc2)nn1 |
| InChI | InChI=1S/C22H30N6O3/c1-16(29)23-8-9-24-22(30)21-14-27-10-7-17(21)11-19(27)13-28-12-18(25-26-28)15-31-20-5-3-2-4-6-20/h2-6,12,17,19,21H,7-11,13-15H2,1H3,(H,23,29)(H,24,30)/t17-,19+,21-/m0/s1 |
| InChIKey | MIPUQHSQWFNHOI-DSKINZAPSA-N |
| XLogP | 0.82 |
| TPSA | 101.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.52 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|