C17H21ClN2O2S — CID 119427157
3-methoxy-5-phenyl-N-piperidin-3-ylthiophene-2-carboxamide;hydrochloride (PubChem CID 119427157) has the molecular formula C17H21ClN2O2S and a molecular weight of 352.89 g/mol. Its IUPAC name is 3-methoxy-5-phenyl-N-piperidin-3-ylthiophene-2-carboxamide;hydrochloride.
| Compound Name | 3-methoxy-5-phenyl-N-piperidin-3-ylthiophene-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119427157 |
| Molecular Formula | C17H21ClN2O2S |
| Molecular Weight | 352.89 g/mol |
| Exact Mass | 352.10 |
| IUPAC Name | 3-methoxy-5-phenyl-N-piperidin-3-ylthiophene-2-carboxamide;hydrochloride |
| SMILES | COc1cc(-c2ccccc2)sc1C(=O)NC1CCCNC1.Cl |
| InChI | InChI=1S/C17H20N2O2S.ClH/c1-21-14-10-15(12-6-3-2-4-7-12)22-16(14)17(20)19-13-8-5-9-18-11-13;/h2-4,6-7,10,13,18H,5,8-9,11H2,1H3,(H,19,20);1H |
| InChIKey | BHFOZZMMJUIKIV-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.89 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |