C17H18BrN3O2 — CID 119427630
6-(3-bromophenoxy)-N-piperidin-3-ylpyridine-3-carboxamide (PubChem CID 119427630) has the molecular formula C17H18BrN3O2 and a molecular weight of 376.25 g/mol. Its IUPAC name is 6-(3-bromophenoxy)-N-piperidin-3-ylpyridine-3-carboxamide.
| Compound Name | 6-(3-bromophenoxy)-N-piperidin-3-ylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 119427630 |
| Molecular Formula | C17H18BrN3O2 |
| Molecular Weight | 376.25 g/mol |
| Exact Mass | 375.06 |
| IUPAC Name | 6-(3-bromophenoxy)-N-piperidin-3-ylpyridine-3-carboxamide |
| SMILES | O=C(NC1CCCNC1)c1ccc(Oc2cccc(Br)c2)nc1 |
| InChI | InChI=1S/C17H18BrN3O2/c18-13-3-1-5-15(9-13)23-16-7-6-12(10-20-16)17(22)21-14-4-2-8-19-11-14/h1,3,5-7,9-10,14,19H,2,4,8,11H2,(H,21,22) |
| InChIKey | KEGKVSBSLBZBRT-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.25 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |