C14H20ClN3O5 — CID 119427739
4,5-dimethoxy-2-nitro-N-piperidin-3-ylbenzamide;hydrochloride (PubChem CID 119427739) has the molecular formula C14H20ClN3O5 and a molecular weight of 345.78 g/mol. Its IUPAC name is 4,5-dimethoxy-2-nitro-N-piperidin-3-ylbenzamide;hydrochloride.
| Compound Name | 4,5-dimethoxy-2-nitro-N-piperidin-3-ylbenzamide;hydrochloride |
|---|---|
| PubChem CID | 119427739 |
| Molecular Formula | C14H20ClN3O5 |
| Molecular Weight | 345.78 g/mol |
| Exact Mass | 345.11 |
| IUPAC Name | 4,5-dimethoxy-2-nitro-N-piperidin-3-ylbenzamide;hydrochloride |
| SMILES | COc1cc(C(=O)NC2CCCNC2)c([N+](=O)[O-])cc1OC.Cl |
| InChI | InChI=1S/C14H19N3O5.ClH/c1-21-12-6-10(11(17(19)20)7-13(12)22-2)14(18)16-9-4-3-5-15-8-9;/h6-7,9,15H,3-5,8H2,1-2H3,(H,16,18);1H |
| InChIKey | XVIVNVHOYZPBKA-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 102.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.78 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|