C12H22Cl2N4O — CID 119427806
3-(1-methylpyrazol-4-yl)-N-piperidin-3-ylpropanamide;dihydrochloride (PubChem CID 119427806) has the molecular formula C12H22Cl2N4O and a molecular weight of 309.24 g/mol. Its IUPAC name is 3-(1-methylpyrazol-4-yl)-N-piperidin-3-ylpropanamide;dihydrochloride.
| Compound Name | 3-(1-methylpyrazol-4-yl)-N-piperidin-3-ylpropanamide;dihydrochloride |
|---|---|
| PubChem CID | 119427806 |
| Molecular Formula | C12H22Cl2N4O |
| Molecular Weight | 309.24 g/mol |
| Exact Mass | 308.12 |
| IUPAC Name | 3-(1-methylpyrazol-4-yl)-N-piperidin-3-ylpropanamide;dihydrochloride |
| SMILES | Cl.Cl.Cn1cc(CCC(=O)NC2CCCNC2)cn1 |
| InChI | InChI=1S/C12H20N4O.2ClH/c1-16-9-10(7-14-16)4-5-12(17)15-11-3-2-6-13-8-11;;/h7,9,11,13H,2-6,8H2,1H3,(H,15,17);2*1H |
| InChIKey | NMNLYGCJRQCGGY-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.24 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |