C12H23ClN4O — CID 119429695
1-tert-butyl-N-[3-(methylamino)propyl]pyrazole-4-carboxamide;hydrochloride (PubChem CID 119429695) has the molecular formula C12H23ClN4O and a molecular weight of 274.80 g/mol. Its IUPAC name is 1-tert-butyl-N-[3-(methylamino)propyl]pyrazole-4-carboxamide;hydrochloride.
| Compound Name | 1-tert-butyl-N-[3-(methylamino)propyl]pyrazole-4-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119429695 |
| Molecular Formula | C12H23ClN4O |
| Molecular Weight | 274.80 g/mol |
| Exact Mass | 274.16 |
| IUPAC Name | 1-tert-butyl-N-[3-(methylamino)propyl]pyrazole-4-carboxamide;hydrochloride |
| SMILES | CNCCCNC(=O)c1cnn(C(C)(C)C)c1.Cl |
| InChI | InChI=1S/C12H22N4O.ClH/c1-12(2,3)16-9-10(8-15-16)11(17)14-7-5-6-13-4;/h8-9,13H,5-7H2,1-4H3,(H,14,17);1H |
| InChIKey | VJXOOERQEFDQPJ-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.80 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|