C23H26ClN3O4 — CID 11942994
N-(1,3-benzodioxol-5-ylmethyl)-2-[(3R,4S)-1-(2-chloropyridine-4-carbonyl)-3-ethylpiperidin-4-yl]acetamide (PubChem CID 11942994) has the molecular formula C23H26ClN3O4 and a molecular weight of 443.93 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethyl)-2-[(3R,4S)-1-(2-chloropyridine-4-carbonyl)-3-ethylpiperidin-4-yl]acetamide.
| Compound Name | N-(1,3-benzodioxol-5-ylmethyl)-2-[(3R,4S)-1-(2-chloropyridine-4-carbonyl)-3-ethylpiperidin-4-yl]acetamide |
|---|---|
| PubChem CID | 11942994 |
| Molecular Formula | C23H26ClN3O4 |
| Molecular Weight | 443.93 g/mol |
| Exact Mass | 443.16 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethyl)-2-[(3R,4S)-1-(2-chloropyridine-4-carbonyl)-3-ethylpiperidin-4-yl]acetamide |
| SMILES | CC[C@H]1CN(C(=O)c2ccnc(Cl)c2)CC[C@H]1CC(=O)NCc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C23H26ClN3O4/c1-2-16-13-27(23(29)18-5-7-25-21(24)10-18)8-6-17(16)11-22(28)26-12-15-3-4-19-20(9-15)31-14-30-19/h3-5,7,9-10,16-17H,2,6,8,11-14H2,1H3,(H,26,28)/t16-,17-/m0/s1 |
| InChIKey | FUHCZKLEEGQMHF-IRXDYDNUSA-N |
| XLogP | 3.66 |
| TPSA | 80.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.93 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|