C15H20Cl3N3O2 — CID 119430250
2-(5-chloroquinolin-8-yl)oxy-N-[3-(methylamino)propyl]acetamide;dihydrochloride (PubChem CID 119430250) has the molecular formula C15H20Cl3N3O2 and a molecular weight of 380.70 g/mol. Its IUPAC name is 2-(5-chloroquinolin-8-yl)oxy-N-[3-(methylamino)propyl]acetamide;dihydrochloride.
| Compound Name | 2-(5-chloroquinolin-8-yl)oxy-N-[3-(methylamino)propyl]acetamide;dihydrochloride |
|---|---|
| PubChem CID | 119430250 |
| Molecular Formula | C15H20Cl3N3O2 |
| Molecular Weight | 380.70 g/mol |
| Exact Mass | 379.06 |
| IUPAC Name | 2-(5-chloroquinolin-8-yl)oxy-N-[3-(methylamino)propyl]acetamide;dihydrochloride |
| SMILES | CNCCCNC(=O)COc1ccc(Cl)c2cccnc12.Cl.Cl |
| InChI | InChI=1S/C15H18ClN3O2.2ClH/c1-17-7-3-9-18-14(20)10-21-13-6-5-12(16)11-4-2-8-19-15(11)13;;/h2,4-6,8,17H,3,7,9-10H2,1H3,(H,18,20);2*1H |
| InChIKey | MMHMYLCXUKGGQH-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.70 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|