C13H21Cl2N5O — CID 119430925
1,3-dimethyl-N-[3-(methylamino)propyl]pyrazolo[5,4-b]pyridine-5-carboxamide;dihydrochloride (PubChem CID 119430925) has the molecular formula C13H21Cl2N5O and a molecular weight of 334.25 g/mol. Its IUPAC name is 1,3-dimethyl-N-[3-(methylamino)propyl]pyrazolo[5,4-b]pyridine-5-carboxamide;dihydrochloride.
| Compound Name | 1,3-dimethyl-N-[3-(methylamino)propyl]pyrazolo[5,4-b]pyridine-5-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 119430925 |
| Molecular Formula | C13H21Cl2N5O |
| Molecular Weight | 334.25 g/mol |
| Exact Mass | 333.11 |
| IUPAC Name | 1,3-dimethyl-N-[3-(methylamino)propyl]pyrazolo[5,4-b]pyridine-5-carboxamide;dihydrochloride |
| SMILES | CNCCCNC(=O)c1cnc2c(c1)c(C)nn2C.Cl.Cl |
| InChI | InChI=1S/C13H19N5O.2ClH/c1-9-11-7-10(8-16-12(11)18(3)17-9)13(19)15-6-4-5-14-2;;/h7-8,14H,4-6H2,1-3H3,(H,15,19);2*1H |
| InChIKey | AXDIFDBWEQIWKM-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.25 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|