C21H28N2O2 — CID 11943196
[(2R,4S,5S)-5-ethynyl-1-azabicyclo[2.2.2]octan-2-yl]methyl N-(4-tert-butylphenyl)carbamate (PubChem CID 11943196) has the molecular formula C21H28N2O2 and a molecular weight of 340.47 g/mol. Its IUPAC name is [(2R,4S,5S)-5-ethynyl-1-azabicyclo[2.2.2]octan-2-yl]methyl N-(4-tert-butylphenyl)carbamate.
| Compound Name | [(2R,4S,5S)-5-ethynyl-1-azabicyclo[2.2.2]octan-2-yl]methyl N-(4-tert-butylphenyl)carbamate |
|---|---|
| PubChem CID | 11943196 |
| Molecular Formula | C21H28N2O2 |
| Molecular Weight | 340.47 g/mol |
| Exact Mass | 340.22 |
| IUPAC Name | [(2R,4S,5S)-5-ethynyl-1-azabicyclo[2.2.2]octan-2-yl]methyl N-(4-tert-butylphenyl)carbamate |
| SMILES | C#C[C@H]1CN2CC[C@H]1C[C@@H]2COC(=O)Nc1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C21H28N2O2/c1-5-15-13-23-11-10-16(15)12-19(23)14-25-20(24)22-18-8-6-17(7-9-18)21(2,3)4/h1,6-9,15-16,19H,10-14H2,2-4H3,(H,22,24)/t15-,16-,19+/m0/s1 |
| InChIKey | BWRCJOWRXUXAFT-TXPKVOOTSA-N |
| XLogP | 3.88 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.47 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|